C19H18ClNO — CID 91674289
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2,4-dimethylaniline (PubChem CID 91674289) has the molecular formula C19H18ClNO and a molecular weight of 311.81 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2,4-dimethylaniline.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 91674289 |
| Molecular Formula | C19H18ClNO |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2,4-dimethylaniline |
| SMILES | Cc1ccc(NCc2ccc(-c3ccc(Cl)cc3)o2)c(C)c1 |
| InChI | InChI=1S/C19H18ClNO/c1-13-3-9-18(14(2)11-13)21-12-17-8-10-19(22-17)15-4-6-16(20)7-5-15/h3-11,21H,12H2,1-2H3 |
| InChIKey | TWIVXIGSUJHDEH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |