C19H21Br2NO — CID 17210373
2-(cyclohexen-1-yl)-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]ethanamine (PubChem CID 17210373) has the molecular formula C19H21Br2NO and a molecular weight of 439.19 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]ethanamine.
| Compound Name | 2-(cyclohexen-1-yl)-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 17210373 |
| Molecular Formula | C19H21Br2NO |
| Molecular Weight | 439.19 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | 2-(cyclohexen-1-yl)-N-[[5-(2,4-dibromophenyl)furan-2-yl]methyl]ethanamine |
| SMILES | Brc1ccc(-c2ccc(CNCCC3=CCCCC3)o2)c(Br)c1 |
| InChI | InChI=1S/C19H21Br2NO/c20-15-6-8-17(18(21)12-15)19-9-7-16(23-19)13-22-11-10-14-4-2-1-3-5-14/h4,6-9,12,22H,1-3,5,10-11,13H2 |
| InChIKey | MGRYKBGMDBDIOJ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.19 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|