C12H16INO — CID 106169331
2-(cyclopenten-1-yl)-N-[(5-iodofuran-2-yl)methyl]ethanamine (PubChem CID 106169331) has the molecular formula C12H16INO and a molecular weight of 317.17 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-N-[(5-iodofuran-2-yl)methyl]ethanamine.
| Compound Name | 2-(cyclopenten-1-yl)-N-[(5-iodofuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106169331 |
| Molecular Formula | C12H16INO |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2-(cyclopenten-1-yl)-N-[(5-iodofuran-2-yl)methyl]ethanamine |
| SMILES | Ic1ccc(CNCCC2=CCCC2)o1 |
| InChI | InChI=1S/C12H16INO/c13-12-6-5-11(15-12)9-14-8-7-10-3-1-2-4-10/h3,5-6,14H,1-2,4,7-9H2 |
| InChIKey | ZLAPOOPPPFCJGZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|