C19H18F3NO3 — CID 59149603
(E)-1-piperidin-1-yl-3-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]prop-2-en-1-one (PubChem CID 59149603) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is (E)-1-piperidin-1-yl-3-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-piperidin-1-yl-3-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59149603 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (E)-1-piperidin-1-yl-3-[5-[2-(trifluoromethoxy)phenyl]furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2OC(F)(F)F)o1)N1CCCCC1 |
| InChI | InChI=1S/C19H18F3NO3/c20-19(21,22)26-17-7-3-2-6-15(17)16-10-8-14(25-16)9-11-18(24)23-12-4-1-5-13-23/h2-3,6-11H,1,4-5,12-13H2/b11-9+ |
| InChIKey | NCSBEDVSRNJLNY-PKNBQFBNSA-N |
| XLogP | 4.87 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|