C20H18F4N2O2 — CID 55616861
(E)-1-[4-(2-fluorophenyl)piperazin-1-yl]-3-[2-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 55616861) has the molecular formula C20H18F4N2O2 and a molecular weight of 394.37 g/mol. Its IUPAC name is (E)-1-[4-(2-fluorophenyl)piperazin-1-yl]-3-[2-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2-fluorophenyl)piperazin-1-yl]-3-[2-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55616861 |
| Molecular Formula | C20H18F4N2O2 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (E)-1-[4-(2-fluorophenyl)piperazin-1-yl]-3-[2-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1OC(F)(F)F)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H18F4N2O2/c21-16-6-2-3-7-17(16)25-11-13-26(14-12-25)19(27)10-9-15-5-1-4-8-18(15)28-20(22,23)24/h1-10H,11-14H2/b10-9+ |
| InChIKey | YKIUXWUUDMEGAQ-MDZDMXLPSA-N |
| XLogP | 4.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|