C14H15FN2O4 — CID 107829734
(2R)-5-amino-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-5-oxopentanoic acid (PubChem CID 107829734) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is (2R)-5-amino-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107829734 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (2R)-5-amino-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](NC(=O)/C=C/c1ccccc1F)C(=O)O |
| InChI | InChI=1S/C14H15FN2O4/c15-10-4-2-1-3-9(10)5-8-13(19)17-11(14(20)21)6-7-12(16)18/h1-5,8,11H,6-7H2,(H2,16,18)(H,17,19)(H,20,21)/b8-5+/t11-/m1/s1 |
| InChIKey | YYUXFEOSLWVVRL-AYLMVEPYSA-N |
| XLogP | 0.67 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|