C11H11FN2O3 — CID 112674420
(E)-N-(2-amino-2-oxoethoxy)-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 112674420) has the molecular formula C11H11FN2O3 and a molecular weight of 238.22 g/mol. Its IUPAC name is (E)-N-(2-amino-2-oxoethoxy)-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-amino-2-oxoethoxy)-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 112674420 |
| Molecular Formula | C11H11FN2O3 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (E)-N-(2-amino-2-oxoethoxy)-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | NC(=O)CONC(=O)/C=C/c1ccccc1F |
| InChI | InChI=1S/C11H11FN2O3/c12-9-4-2-1-3-8(9)5-6-11(16)14-17-7-10(13)15/h1-6H,7H2,(H2,13,15)(H,14,16)/b6-5+ |
| InChIKey | JFLPJCLMSHTCKX-AATRIKPKSA-N |
| XLogP | 0.37 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|