C20H21NO5 — CID 91189294
N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(3,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 91189294) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(3,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(3,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 91189294 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-(3,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NC(C)c2ccc3c(c2)OCO3)cc(OC)c1 |
| InChI | InChI=1S/C20H21NO5/c1-13(15-5-6-18-19(10-15)26-12-25-18)21-20(22)7-4-14-8-16(23-2)11-17(9-14)24-3/h4-11,13H,12H2,1-3H3,(H,21,22) |
| InChIKey | VYYATEVLLLXNID-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|