C21H27ClN3O2S+ — CID 8678414
[(1S)-2-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)-1-(2-chlorophenyl)ethyl]-diethylazanium (PubChem CID 8678414) has the molecular formula C21H27ClN3O2S+ and a molecular weight of 420.99 g/mol. Its IUPAC name is [(1S)-2-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)-1-(2-chlorophenyl)ethyl]-diethylazanium.
| Compound Name | [(1S)-2-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)-1-(2-chlorophenyl)ethyl]-diethylazanium |
|---|---|
| PubChem CID | 8678414 |
| Molecular Formula | C21H27ClN3O2S+ |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [(1S)-2-(1,3-benzodioxol-5-ylmethylcarbamothioylamino)-1-(2-chlorophenyl)ethyl]-diethylazanium |
| SMILES | CC[NH+](CC)[C@H](CNC(=S)NCc1ccc2c(c1)OCO2)c1ccccc1Cl |
| InChI | InChI=1S/C21H26ClN3O2S/c1-3-25(4-2)18(16-7-5-6-8-17(16)22)13-24-21(28)23-12-15-9-10-19-20(11-15)27-14-26-19/h5-11,18H,3-4,12-14H2,1-2H3,(H2,23,24,28)/p+1/t18-/m1/s1 |
| InChIKey | ZNJULWOMAKZRPM-GOSISDBHSA-O |
| XLogP | 2.70 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|