C18H21FN2OS2 — CID 8558876
2-[2-(4-fluorophenyl)sulfanylethyl-methylamino]-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 8558876) has the molecular formula C18H21FN2OS2 and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)sulfanylethyl-methylamino]-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[2-(4-fluorophenyl)sulfanylethyl-methylamino]-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 8558876 |
| Molecular Formula | C18H21FN2OS2 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-[2-(4-fluorophenyl)sulfanylethyl-methylamino]-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)CN(C)CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2OS2/c1-21(11-12-24-15-9-7-14(19)8-10-15)13-18(22)20-16-5-3-4-6-17(16)23-2/h3-10H,11-13H2,1-2H3,(H,20,22) |
| InChIKey | BRTOPWRAIZVNJX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |