C20H24N4O3 — CID 86996307
N-[[4-(dimethylamino)phenyl]methyl]-N'-[2-(dimethylcarbamoyl)phenyl]oxamide (PubChem CID 86996307) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-N'-[2-(dimethylcarbamoyl)phenyl]oxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-N'-[2-(dimethylcarbamoyl)phenyl]oxamide |
|---|---|
| PubChem CID | 86996307 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-N'-[2-(dimethylcarbamoyl)phenyl]oxamide |
| SMILES | CN(C)C(=O)c1ccccc1NC(=O)C(=O)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H24N4O3/c1-23(2)15-11-9-14(10-12-15)13-21-18(25)19(26)22-17-8-6-5-7-16(17)20(27)24(3)4/h5-12H,13H2,1-4H3,(H,21,25)(H,22,26) |
| InChIKey | WGZHVMMCOTUKAK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|