C20H23FN2O4 — CID 90599359
N'-[2-(2-fluorophenyl)-2-methoxypropyl]-N-[(3-methoxyphenyl)methyl]oxamide (PubChem CID 90599359) has the molecular formula C20H23FN2O4 and a molecular weight of 374.41 g/mol. Its IUPAC name is N'-[2-(2-fluorophenyl)-2-methoxypropyl]-N-[(3-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[2-(2-fluorophenyl)-2-methoxypropyl]-N-[(3-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 90599359 |
| Molecular Formula | C20H23FN2O4 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N'-[2-(2-fluorophenyl)-2-methoxypropyl]-N-[(3-methoxyphenyl)methyl]oxamide |
| SMILES | COc1cccc(CNC(=O)C(=O)NCC(C)(OC)c2ccccc2F)c1 |
| InChI | InChI=1S/C20H23FN2O4/c1-20(27-3,16-9-4-5-10-17(16)21)13-23-19(25)18(24)22-12-14-7-6-8-15(11-14)26-2/h4-11H,12-13H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | ZRHWCVOSOMXIAK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|