C18H18F3N3O2 — CID 166428252
4-(2-benzamidoethylamino)-N-methyl-3-(trifluoromethyl)benzamide (PubChem CID 166428252) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 4-(2-benzamidoethylamino)-N-methyl-3-(trifluoromethyl)benzamide.
| Compound Name | 4-(2-benzamidoethylamino)-N-methyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 166428252 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-(2-benzamidoethylamino)-N-methyl-3-(trifluoromethyl)benzamide |
| SMILES | CNC(=O)c1ccc(NCCNC(=O)c2ccccc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F3N3O2/c1-22-16(25)13-7-8-15(14(11-13)18(19,20)21)23-9-10-24-17(26)12-5-3-2-4-6-12/h2-8,11,23H,9-10H2,1H3,(H,22,25)(H,24,26) |
| InChIKey | USICJGXNSIZFFZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|