C13H18F3N3O — CID 62234841
4-hydrazinyl-N-pentyl-3-(trifluoromethyl)benzamide (PubChem CID 62234841) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 4-hydrazinyl-N-pentyl-3-(trifluoromethyl)benzamide.
| Compound Name | 4-hydrazinyl-N-pentyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 62234841 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-hydrazinyl-N-pentyl-3-(trifluoromethyl)benzamide |
| SMILES | CCCCCNC(=O)c1ccc(NN)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3N3O/c1-2-3-4-7-18-12(20)9-5-6-11(19-17)10(8-9)13(14,15)16/h5-6,8,19H,2-4,7,17H2,1H3,(H,18,20) |
| InChIKey | QDVKOHVWUGIOAS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|