C11H14F3N3O — CID 62241169
N-ethyl-4-hydrazinyl-N-methyl-3-(trifluoromethyl)benzamide (PubChem CID 62241169) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is N-ethyl-4-hydrazinyl-N-methyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-ethyl-4-hydrazinyl-N-methyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 62241169 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-ethyl-4-hydrazinyl-N-methyl-3-(trifluoromethyl)benzamide |
| SMILES | CCN(C)C(=O)c1ccc(NN)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3N3O/c1-3-17(2)10(18)7-4-5-9(16-15)8(6-7)11(12,13)14/h4-6,16H,3,15H2,1-2H3 |
| InChIKey | ANDFOCLEMQGBIM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|