C13H18F3N3O2 — CID 62236816
4-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methyl-3-(trifluoromethyl)benzamide (PubChem CID 62236816) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 4-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methyl-3-(trifluoromethyl)benzamide.
| Compound Name | 4-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 62236816 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-hydrazinyl-N-(1-methoxypropan-2-yl)-N-methyl-3-(trifluoromethyl)benzamide |
| SMILES | COCC(C)N(C)C(=O)c1ccc(NN)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3N3O2/c1-8(7-21-3)19(2)12(20)9-4-5-11(18-17)10(6-9)13(14,15)16/h4-6,8,18H,7,17H2,1-3H3 |
| InChIKey | MTZUSMOFPSRSII-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|