C13H19F3N4O — CID 62247665
N-[2-(dimethylamino)propyl]-4-hydrazinyl-3-(trifluoromethyl)benzamide (PubChem CID 62247665) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is N-[2-(dimethylamino)propyl]-4-hydrazinyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(dimethylamino)propyl]-4-hydrazinyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 62247665 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[2-(dimethylamino)propyl]-4-hydrazinyl-3-(trifluoromethyl)benzamide |
| SMILES | CC(CNC(=O)c1ccc(NN)c(C(F)(F)F)c1)N(C)C |
| InChI | InChI=1S/C13H19F3N4O/c1-8(20(2)3)7-18-12(21)9-4-5-11(19-17)10(6-9)13(14,15)16/h4-6,8,19H,7,17H2,1-3H3,(H,18,21) |
| InChIKey | TVNOWKKTZLPQCS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|