C14H12F3NO3 — CID 18149564
N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]furan-3-carboxamide (PubChem CID 18149564) has the molecular formula C14H12F3NO3 and a molecular weight of 299.25 g/mol. Its IUPAC name is N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]furan-3-carboxamide.
| Compound Name | N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 18149564 |
| Molecular Formula | C14H12F3NO3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]furan-3-carboxamide |
| SMILES | O=C(NCc1ccc(OCC(F)(F)F)cc1)c1ccoc1 |
| InChI | InChI=1S/C14H12F3NO3/c15-14(16,17)9-21-12-3-1-10(2-4-12)7-18-13(19)11-5-6-20-8-11/h1-6,8H,7,9H2,(H,18,19) |
| InChIKey | CWURFSLITYBJBE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |