C21H17N3O4S — CID 27685699
3-methyl-N'-[4-(1,3-thiazol-4-ylmethoxy)benzoyl]-1-benzofuran-2-carbohydrazide (PubChem CID 27685699) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is 3-methyl-N'-[4-(1,3-thiazol-4-ylmethoxy)benzoyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 3-methyl-N'-[4-(1,3-thiazol-4-ylmethoxy)benzoyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 27685699 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 3-methyl-N'-[4-(1,3-thiazol-4-ylmethoxy)benzoyl]-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccc(OCc3cscn3)cc2)oc2ccccc12 |
| InChI | InChI=1S/C21H17N3O4S/c1-13-17-4-2-3-5-18(17)28-19(13)21(26)24-23-20(25)14-6-8-16(9-7-14)27-10-15-11-29-12-22-15/h2-9,11-12H,10H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | BGRQPSAKFAYCJQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|