C22H19N3O3S2 — CID 30291084
3-methyl-N'-[4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]-1-benzofuran-2-carbohydrazide (PubChem CID 30291084) has the molecular formula C22H19N3O3S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 3-methyl-N'-[4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 3-methyl-N'-[4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 30291084 |
| Molecular Formula | C22H19N3O3S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 3-methyl-N'-[4-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]benzoyl]-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1nc(CSc2ccc(C(=O)NNC(=O)c3oc4ccccc4c3C)cc2)cs1 |
| InChI | InChI=1S/C22H19N3O3S2/c1-13-18-5-3-4-6-19(18)28-20(13)22(27)25-24-21(26)15-7-9-17(10-8-15)30-12-16-11-29-14(2)23-16/h3-11H,12H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | RKTMWGUQUCXWHK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|