C18H15N3O4S — CID 26737793
N-(2-methyl-3-nitrophenyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 26737793) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is N-(2-methyl-3-nitrophenyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-(2-methyl-3-nitrophenyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 26737793 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-(2-methyl-3-nitrophenyl)-4-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | Cc1c(NC(=O)c2ccc(OCc3cscn3)cc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15N3O4S/c1-12-16(3-2-4-17(12)21(23)24)20-18(22)13-5-7-15(8-6-13)25-9-14-10-26-11-19-14/h2-8,10-11H,9H2,1H3,(H,20,22) |
| InChIKey | MJIKMPDJATYDAD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|