C19H20N4O3 — CID 34746020
2-[[4-[(carbamoylamino)methyl]benzoyl]amino]-N-prop-2-enylbenzamide (PubChem CID 34746020) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[[4-[(carbamoylamino)methyl]benzoyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[4-[(carbamoylamino)methyl]benzoyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 34746020 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[[4-[(carbamoylamino)methyl]benzoyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)c1ccc(CNC(N)=O)cc1 |
| InChI | InChI=1S/C19H20N4O3/c1-2-11-21-18(25)15-5-3-4-6-16(15)23-17(24)14-9-7-13(8-10-14)12-22-19(20)26/h2-10H,1,11-12H2,(H,21,25)(H,23,24)(H3,20,22,26) |
| InChIKey | PRQPGPUOEFXMJJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|