C18H17BrN2O2 — CID 26706664
2-[[2-(4-bromophenyl)acetyl]amino]-N-prop-2-enylbenzamide (PubChem CID 26706664) has the molecular formula C18H17BrN2O2 and a molecular weight of 373.25 g/mol. Its IUPAC name is 2-[[2-(4-bromophenyl)acetyl]amino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[[2-(4-bromophenyl)acetyl]amino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 26706664 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-[[2-(4-bromophenyl)acetyl]amino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H17BrN2O2/c1-2-11-20-18(23)15-5-3-4-6-16(15)21-17(22)12-13-7-9-14(19)10-8-13/h2-10H,1,11-12H2,(H,20,23)(H,21,22) |
| InChIKey | GSJXEVOPVOZIGR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|