C19H20F3N3O — CID 109166365
2-(cyclohexylamino)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide (PubChem CID 109166365) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-(cyclohexylamino)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109166365 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-(cyclohexylamino)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)c1ccnc(NC2CCCCC2)c1 |
| InChI | InChI=1S/C19H20F3N3O/c20-19(21,22)15-8-4-5-9-16(15)25-18(26)13-10-11-23-17(12-13)24-14-6-2-1-3-7-14/h4-5,8-12,14H,1-3,6-7H2,(H,23,24)(H,25,26) |
| InChIKey | ZWHSZUXUYCZDFS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |