C18H18F3N3O — CID 122149926
2-(3-methylpyrrolidin-1-yl)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide (PubChem CID 122149926) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is 2-(3-methylpyrrolidin-1-yl)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-(3-methylpyrrolidin-1-yl)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 122149926 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-(3-methylpyrrolidin-1-yl)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| SMILES | CC1CCN(c2cc(C(=O)Nc3ccccc3C(F)(F)F)ccn2)C1 |
| InChI | InChI=1S/C18H18F3N3O/c1-12-7-9-24(11-12)16-10-13(6-8-22-16)17(25)23-15-5-3-2-4-14(15)18(19,20)21/h2-6,8,10,12H,7,9,11H2,1H3,(H,23,25) |
| InChIKey | NFQNNNOMBYWWPJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |