C18H20BrN3O — CID 109166535
N-(2-bromophenyl)-2-(4-methylpiperidin-1-yl)pyridine-4-carboxamide (PubChem CID 109166535) has the molecular formula C18H20BrN3O and a molecular weight of 374.28 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(4-methylpiperidin-1-yl)pyridine-4-carboxamide.
| Compound Name | N-(2-bromophenyl)-2-(4-methylpiperidin-1-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109166535 |
| Molecular Formula | C18H20BrN3O |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-(2-bromophenyl)-2-(4-methylpiperidin-1-yl)pyridine-4-carboxamide |
| SMILES | CC1CCN(c2cc(C(=O)Nc3ccccc3Br)ccn2)CC1 |
| InChI | InChI=1S/C18H20BrN3O/c1-13-7-10-22(11-8-13)17-12-14(6-9-20-17)18(23)21-16-5-3-2-4-15(16)19/h2-6,9,12-13H,7-8,10-11H2,1H3,(H,21,23) |
| InChIKey | AVIRZDZKAKXKCX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |