C20H16F3N3O — CID 109176395
2-(N-methylanilino)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide (PubChem CID 109176395) has the molecular formula C20H16F3N3O and a molecular weight of 371.36 g/mol. Its IUPAC name is 2-(N-methylanilino)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-(N-methylanilino)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109176395 |
| Molecular Formula | C20H16F3N3O |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-(N-methylanilino)-N-[2-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| SMILES | CN(c1ccccc1)c1cc(C(=O)Nc2ccccc2C(F)(F)F)ccn1 |
| InChI | InChI=1S/C20H16F3N3O/c1-26(15-7-3-2-4-8-15)18-13-14(11-12-24-18)19(27)25-17-10-6-5-9-16(17)20(21,22)23/h2-13H,1H3,(H,25,27) |
| InChIKey | AAIIFGDQCUCWIW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |