C12H18ClN3OS — CID 114148540
3-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]cyclohexan-1-ol (PubChem CID 114148540) has the molecular formula C12H18ClN3OS and a molecular weight of 287.82 g/mol. Its IUPAC name is 3-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]cyclohexan-1-ol.
| Compound Name | 3-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 114148540 |
| Molecular Formula | C12H18ClN3OS |
| Molecular Weight | 287.82 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-[[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]methyl]cyclohexan-1-ol |
| SMILES | CSc1nc(Cl)cc(NCC2CCCC(O)C2)n1 |
| InChI | InChI=1S/C12H18ClN3OS/c1-18-12-15-10(13)6-11(16-12)14-7-8-3-2-4-9(17)5-8/h6,8-9,17H,2-5,7H2,1H3,(H,14,15,16) |
| InChIKey | YVTRAWMOHUGXDQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |