About N-cyclohexylpyridin-2-amine;methanamine
N-cyclohexylpyridin-2-amine;methanamine (PubChem CID 143850003) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is N-cyclohexylpyridin-2-amine;methanamine.
Molecular Properties
| Compound Name | N-cyclohexylpyridin-2-amine;methanamine |
| PubChem CID | 143850003 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N-cyclohexylpyridin-2-amine;methanamine |
| SMILES | CN.c1ccc(NC2CCCCC2)nc1 |
| InChI | InChI=1S/C11H16N2.CH5N/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;1-2/h4-5,8-10H,1-3,6-7H2,(H,12,13);2H2,1H3 |
| InChIKey | RKZOBTVEHHRDPH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexylpyridin-2-amine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylpyridin-2-amine;methanamine?
The IUPAC name of N-cyclohexylpyridin-2-amine;methanamine (CID 143850003) is N-cyclohexylpyridin-2-amine;methanamine.
What is the SMILES notation for N-cyclohexylpyridin-2-amine;methanamine?
The canonical SMILES for N-cyclohexylpyridin-2-amine;methanamine is CN.c1ccc(NC2CCCCC2)nc1.
What is the InChIKey of N-cyclohexylpyridin-2-amine;methanamine?
The InChIKey is RKZOBTVEHHRDPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2.CH5N/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;1-2/h4-5,8-10H,1-3,6-7H2,(H,12,13);2H2,1H3.
What are the key properties of N-cyclohexylpyridin-2-amine;methanamine?
N-cyclohexylpyridin-2-amine;methanamine has a molecular weight of 207.32 g/mol, XLogP of 2.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylpyridin-2-amine;methanamine is sourced from PubChem (CID 143850003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).