About N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium
N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium (PubChem CID 160520836) has the molecular formula C14H17N3O
and a molecular weight of 243.31 g/mol. Its IUPAC name is N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium.
Molecular Properties
| Compound Name | N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium |
| PubChem CID | 160520836 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium |
| SMILES | [O-][n+]1ccccc1.c1ccc(NC2CCC2)nc1 |
| InChI | InChI=1S/C9H12N2.C5H5NO/c1-2-7-10-9(6-1)11-8-4-3-5-8;7-6-4-2-1-3-5-6/h1-2,6-8H,3-5H2,(H,10,11);1-5H |
| InChIKey | QUFZRJGQYRPERN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 51.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium?
The IUPAC name of N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium (CID 160520836) is N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium.
What is the SMILES notation for N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium?
The canonical SMILES for N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium is [O-][n+]1ccccc1.c1ccc(NC2CCC2)nc1.
What is the InChIKey of N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium?
The InChIKey is QUFZRJGQYRPERN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.C5H5NO/c1-2-7-10-9(6-1)11-8-4-3-5-8;7-6-4-2-1-3-5-6/h1-2,6-8H,3-5H2,(H,10,11);1-5H.
What are the key properties of N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium?
N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium has a molecular weight of 243.31 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclobutylpyridin-2-amine;1-oxidopyridin-1-ium is sourced from PubChem (CID 160520836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).