C14H18N2S — CID 115145750
N-(1-benzothiophen-3-yl)-5,5-dimethylpyrrolidin-3-amine (PubChem CID 115145750) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is N-(1-benzothiophen-3-yl)-5,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-(1-benzothiophen-3-yl)-5,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115145750 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-(1-benzothiophen-3-yl)-5,5-dimethylpyrrolidin-3-amine |
| SMILES | CC1(C)CC(Nc2csc3ccccc23)CN1 |
| InChI | InChI=1S/C14H18N2S/c1-14(2)7-10(8-15-14)16-12-9-17-13-6-4-3-5-11(12)13/h3-6,9-10,15-16H,7-8H2,1-2H3 |
| InChIKey | PJFGQADDCVLKFM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |