C13H20BrN3 — CID 65343642
4-bromo-2-N-(1-ethylpiperidin-3-yl)benzene-1,2-diamine (PubChem CID 65343642) has the molecular formula C13H20BrN3 and a molecular weight of 298.23 g/mol. Its IUPAC name is 4-bromo-2-N-(1-ethylpiperidin-3-yl)benzene-1,2-diamine.
| Compound Name | 4-bromo-2-N-(1-ethylpiperidin-3-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65343642 |
| Molecular Formula | C13H20BrN3 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-bromo-2-N-(1-ethylpiperidin-3-yl)benzene-1,2-diamine |
| SMILES | CCN1CCCC(Nc2cc(Br)ccc2N)C1 |
| InChI | InChI=1S/C13H20BrN3/c1-2-17-7-3-4-11(9-17)16-13-8-10(14)5-6-12(13)15/h5-6,8,11,16H,2-4,7,9,15H2,1H3 |
| InChIKey | KUGHDZPKLAYSLF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|