C17H22N2O5 — CID 133377630
methyl 2-nitro-5-(6-oxaspiro[4.5]decan-9-ylamino)benzoate (PubChem CID 133377630) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is methyl 2-nitro-5-(6-oxaspiro[4.5]decan-9-ylamino)benzoate.
| Compound Name | methyl 2-nitro-5-(6-oxaspiro[4.5]decan-9-ylamino)benzoate |
|---|---|
| PubChem CID | 133377630 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | methyl 2-nitro-5-(6-oxaspiro[4.5]decan-9-ylamino)benzoate |
| SMILES | COC(=O)c1cc(NC2CCOC3(CCCC3)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N2O5/c1-23-16(20)14-10-12(4-5-15(14)19(21)22)18-13-6-9-24-17(11-13)7-2-3-8-17/h4-5,10,13,18H,2-3,6-9,11H2,1H3 |
| InChIKey | LWXVEMZZBKEFTQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|