C13H16N2O5 — CID 133329818
methyl 5-[(1-hydroxycyclobutyl)methylamino]-2-nitrobenzoate (PubChem CID 133329818) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 5-[(1-hydroxycyclobutyl)methylamino]-2-nitrobenzoate.
| Compound Name | methyl 5-[(1-hydroxycyclobutyl)methylamino]-2-nitrobenzoate |
|---|---|
| PubChem CID | 133329818 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 5-[(1-hydroxycyclobutyl)methylamino]-2-nitrobenzoate |
| SMILES | COC(=O)c1cc(NCC2(O)CCC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N2O5/c1-20-12(16)10-7-9(3-4-11(10)15(18)19)14-8-13(17)5-2-6-13/h3-4,7,14,17H,2,5-6,8H2,1H3 |
| InChIKey | VCZDFXPCYHZPHW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|