C10H15N3O3 — CID 106370612
1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-(oxolan-3-yl)urea (PubChem CID 106370612) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-(oxolan-3-yl)urea.
| Compound Name | 1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-(oxolan-3-yl)urea |
|---|---|
| PubChem CID | 106370612 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-[(5-methyl-1,3-oxazol-2-yl)methyl]-3-(oxolan-3-yl)urea |
| SMILES | Cc1cnc(CNC(=O)NC2CCOC2)o1 |
| InChI | InChI=1S/C10H15N3O3/c1-7-4-11-9(16-7)5-12-10(14)13-8-2-3-15-6-8/h4,8H,2-3,5-6H2,1H3,(H2,12,13,14) |
| InChIKey | GYMQDAKOEMUHOX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |