C28H36N4O6 — CID 1166834
1-(1,3-benzodioxol-5-ylmethyl)-3-[(1S,3S)-3-[(1,3-benzodioxol-5-ylmethylcarbamoylamino)methyl]-3,5,5-trimethylcyclohexyl]urea (PubChem CID 1166834) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1S,3S)-3-[(1,3-benzodioxol-5-ylmethylcarbamoylamino)methyl]-3,5,5-trimethylcyclohexyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1S,3S)-3-[(1,3-benzodioxol-5-ylmethylcarbamoylamino)methyl]-3,5,5-trimethylcyclohexyl]urea |
|---|---|
| PubChem CID | 1166834 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(1S,3S)-3-[(1,3-benzodioxol-5-ylmethylcarbamoylamino)methyl]-3,5,5-trimethylcyclohexyl]urea |
| SMILES | CC1(C)C[C@H](NC(=O)NCc2ccc3c(c2)OCO3)C[C@@](C)(CNC(=O)NCc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C28H36N4O6/c1-27(2)10-20(32-26(34)30-13-19-5-7-22-24(9-19)38-17-36-22)11-28(3,14-27)15-31-25(33)29-12-18-4-6-21-23(8-18)37-16-35-21/h4-9,20H,10-17H2,1-3H3,(H2,29,31,33)(H2,30,32,34)/t20-,28+/m0/s1 |
| InChIKey | CMEZHLSZLTZNPY-WTYVLRPYSA-N |
| XLogP | 4.03 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |