C19H27N3O4 — CID 108508541
N-(1,3-benzodioxol-5-ylmethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 108508541) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 108508541 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)NCc2ccc3c(c2)OCO3)CC(C)(C)N1 |
| InChI | InChI=1S/C19H27N3O4/c1-18(2)8-13(9-19(3,4)22-18)21-17(24)16(23)20-10-12-5-6-14-15(7-12)26-11-25-14/h5-7,13,22H,8-11H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | UBQDBYWTCBNUEB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|