C17H19NO — CID 172780354
N-methyl-7-(4-methylphenyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 172780354) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is N-methyl-7-(4-methylphenyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-methyl-7-(4-methylphenyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 172780354 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-methyl-7-(4-methylphenyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CNC1CCOc2cc(-c3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C17H19NO/c1-12-3-5-13(6-4-12)14-7-8-15-16(18-2)9-10-19-17(15)11-14/h3-8,11,16,18H,9-10H2,1-2H3 |
| InChIKey | OECNQQPIPYYFTD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |