C20H20N4O2 — CID 95266877
1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[4-(pyrazol-1-ylmethyl)phenyl]urea (PubChem CID 95266877) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[4-(pyrazol-1-ylmethyl)phenyl]urea.
| Compound Name | 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[4-(pyrazol-1-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 95266877 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[4-(pyrazol-1-ylmethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(Cn2cccn2)cc1)N[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C20H20N4O2/c25-20(23-18-10-13-26-19-5-2-1-4-17(18)19)22-16-8-6-15(7-9-16)14-24-12-3-11-21-24/h1-9,11-12,18H,10,13-14H2,(H2,22,23,25)/t18-/m0/s1 |
| InChIKey | RDARNJOGSVXOIG-SFHVURJKSA-N |
| XLogP | 3.58 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |