C19H30N4O2 — CID 86778769
N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1-morpholin-4-ylcyclopentane-1-carboxamide (PubChem CID 86778769) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1-morpholin-4-ylcyclopentane-1-carboxamide.
| Compound Name | N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1-morpholin-4-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 86778769 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N-[3-[(5-methyl-2-pyridinyl)amino]propyl]-1-morpholin-4-ylcyclopentane-1-carboxamide |
| SMILES | Cc1ccc(NCCCNC(=O)C2(N3CCOCC3)CCCC2)nc1 |
| InChI | InChI=1S/C19H30N4O2/c1-16-5-6-17(22-15-16)20-9-4-10-21-18(24)19(7-2-3-8-19)23-11-13-25-14-12-23/h5-6,15H,2-4,7-14H2,1H3,(H,20,22)(H,21,24) |
| InChIKey | YKWIMLJIWUNUNH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|