C16H28N2O4S — CID 23634765
S-[(6S)-7-(cyclopentylamino)-6-(methoxycarbonylamino)-7-oxoheptyl] ethanethioate (PubChem CID 23634765) has the molecular formula C16H28N2O4S and a molecular weight of 344.48 g/mol. Its IUPAC name is S-[(6S)-7-(cyclopentylamino)-6-(methoxycarbonylamino)-7-oxoheptyl] ethanethioate.
| Compound Name | S-[(6S)-7-(cyclopentylamino)-6-(methoxycarbonylamino)-7-oxoheptyl] ethanethioate |
|---|---|
| PubChem CID | 23634765 |
| Molecular Formula | C16H28N2O4S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | S-[(6S)-7-(cyclopentylamino)-6-(methoxycarbonylamino)-7-oxoheptyl] ethanethioate |
| SMILES | COC(=O)N[C@@H](CCCCCSC(C)=O)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H28N2O4S/c1-12(19)23-11-7-3-4-10-14(18-16(21)22-2)15(20)17-13-8-5-6-9-13/h13-14H,3-11H2,1-2H3,(H,17,20)(H,18,21)/t14-/m0/s1 |
| InChIKey | OXQZRZYYQBZOFC-AWEZNQCLSA-N |
| XLogP | 2.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|