C16H28N2O4S — CID 159080890
methyl N-[(3S)-1-(4-acetamidocyclohexyl)-5-methylsulfanyl-2-oxopentan-3-yl]carbamate (PubChem CID 159080890) has the molecular formula C16H28N2O4S and a molecular weight of 344.48 g/mol. Its IUPAC name is methyl N-[(3S)-1-(4-acetamidocyclohexyl)-5-methylsulfanyl-2-oxopentan-3-yl]carbamate.
| Compound Name | methyl N-[(3S)-1-(4-acetamidocyclohexyl)-5-methylsulfanyl-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 159080890 |
| Molecular Formula | C16H28N2O4S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl N-[(3S)-1-(4-acetamidocyclohexyl)-5-methylsulfanyl-2-oxopentan-3-yl]carbamate |
| SMILES | COC(=O)N[C@@H](CCSC)C(=O)CC1CCC(NC(C)=O)CC1 |
| InChI | InChI=1S/C16H28N2O4S/c1-11(19)17-13-6-4-12(5-7-13)10-15(20)14(8-9-23-3)18-16(21)22-2/h12-14H,4-10H2,1-3H3,(H,17,19)(H,18,21)/t12?,13?,14-/m0/s1 |
| InChIKey | KAVNROUALJPNHU-RUXDESIVSA-N |
| XLogP | 2.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |