C12H22N2O3S — CID 4253884
methyl 2-(cyclopentylcarbamoylamino)-4-methylsulfanylbutanoate (PubChem CID 4253884) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is methyl 2-(cyclopentylcarbamoylamino)-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-(cyclopentylcarbamoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 4253884 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl 2-(cyclopentylcarbamoylamino)-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C12H22N2O3S/c1-17-11(15)10(7-8-18-2)14-12(16)13-9-5-3-4-6-9/h9-10H,3-8H2,1-2H3,(H2,13,14,16) |
| InChIKey | YSWMMHZFLSBXTE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |