C12H22N2O4S — CID 114118286
(2R)-2-[(3-methoxycyclopentyl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 114118286) has the molecular formula C12H22N2O4S and a molecular weight of 290.39 g/mol. Its IUPAC name is (2R)-2-[(3-methoxycyclopentyl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(3-methoxycyclopentyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 114118286 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (2R)-2-[(3-methoxycyclopentyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | COC1CCC(NC(=O)N[C@H](CCSC)C(=O)O)C1 |
| InChI | InChI=1S/C12H22N2O4S/c1-18-9-4-3-8(7-9)13-12(17)14-10(11(15)16)5-6-19-2/h8-10H,3-7H2,1-2H3,(H,15,16)(H2,13,14,17)/t8?,9?,10-/m1/s1 |
| InChIKey | DUMKNQGHBHVKTC-UDNWOFFPSA-N |
| XLogP | 1.06 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |