C15H29IN2O3S — CID 176696272
tert-butyl N-[1-(cyclobutylamino)-4-[iodo(dimethyl)-λ4-sulfanyl]-1-oxobutan-2-yl]carbamate (PubChem CID 176696272) has the molecular formula C15H29IN2O3S and a molecular weight of 444.38 g/mol. Its IUPAC name is tert-butyl N-[1-(cyclobutylamino)-4-[iodo(dimethyl)-λ4-sulfanyl]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(cyclobutylamino)-4-[iodo(dimethyl)-λ4-sulfanyl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 176696272 |
| Molecular Formula | C15H29IN2O3S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | tert-butyl N-[1-(cyclobutylamino)-4-[iodo(dimethyl)-λ4-sulfanyl]-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCS(C)(C)I)C(=O)NC1CCC1 |
| InChI | InChI=1S/C15H29IN2O3S/c1-15(2,3)21-14(20)18-12(9-10-22(4,5)16)13(19)17-11-7-6-8-11/h11-12H,6-10H2,1-5H3,(H,17,19)(H,18,20) |
| InChIKey | GBFCKDROKRMJSL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|