C17H33N3OS2 — CID 23634894
(2S)-2-(tert-butylcarbamothioylamino)-N-cyclopentyl-7-sulfanylheptanamide (PubChem CID 23634894) has the molecular formula C17H33N3OS2 and a molecular weight of 359.61 g/mol. Its IUPAC name is (2S)-2-(tert-butylcarbamothioylamino)-N-cyclopentyl-7-sulfanylheptanamide.
| Compound Name | (2S)-2-(tert-butylcarbamothioylamino)-N-cyclopentyl-7-sulfanylheptanamide |
|---|---|
| PubChem CID | 23634894 |
| Molecular Formula | C17H33N3OS2 |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (2S)-2-(tert-butylcarbamothioylamino)-N-cyclopentyl-7-sulfanylheptanamide |
| SMILES | CC(C)(C)NC(=S)N[C@@H](CCCCCS)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H33N3OS2/c1-17(2,3)20-16(23)19-14(11-5-4-8-12-22)15(21)18-13-9-6-7-10-13/h13-14,22H,4-12H2,1-3H3,(H,18,21)(H2,19,20,23)/t14-/m0/s1 |
| InChIKey | VXMHHEQJZJBMRW-AWEZNQCLSA-N |
| XLogP | 3.17 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|