C23H42N4O5S2 — CID 57411772
(2S)-2-[[2-methyl-2-[[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-7-sulfanylheptanoyl]amino]propanoyl]amino]-7-sulfanylheptanoic acid (PubChem CID 57411772) has the molecular formula C23H42N4O5S2 and a molecular weight of 518.75 g/mol. Its IUPAC name is (2S)-2-[[2-methyl-2-[[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-7-sulfanylheptanoyl]amino]propanoyl]amino]-7-sulfanylheptanoic acid.
| Compound Name | (2S)-2-[[2-methyl-2-[[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-7-sulfanylheptanoyl]amino]propanoyl]amino]-7-sulfanylheptanoic acid |
|---|---|
| PubChem CID | 57411772 |
| Molecular Formula | C23H42N4O5S2 |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | (2S)-2-[[2-methyl-2-[[(2S)-2-[[(2S)-pyrrolidine-2-carbonyl]amino]-7-sulfanylheptanoyl]amino]propanoyl]amino]-7-sulfanylheptanoic acid |
| SMILES | CC(C)(NC(=O)[C@H](CCCCCS)NC(=O)[C@@H]1CCCN1)C(=O)N[C@@H](CCCCCS)C(=O)O |
| InChI | InChI=1S/C23H42N4O5S2/c1-23(2,22(32)26-18(21(30)31)11-6-4-8-15-34)27-20(29)17(10-5-3-7-14-33)25-19(28)16-12-9-13-24-16/h16-18,24,33-34H,3-15H2,1-2H3,(H,25,28)(H,26,32)(H,27,29)(H,30,31)/t16-,17-,18-/m0/s1 |
| InChIKey | OCUOYMMVIVMVIQ-BZSNNMDCSA-N |
| XLogP | 1.67 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|