C17H25N7O4 — CID 169493567
2-[[5-(diaminomethylideneamino)-2-[[2-(2-diazenylphenyl)acetyl]amino]pentanoyl]amino]propanoic acid (PubChem CID 169493567) has the molecular formula C17H25N7O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[[5-(diaminomethylideneamino)-2-[[2-(2-diazenylphenyl)acetyl]amino]pentanoyl]amino]propanoic acid.
| Compound Name | 2-[[5-(diaminomethylideneamino)-2-[[2-(2-diazenylphenyl)acetyl]amino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 169493567 |
| Molecular Formula | C17H25N7O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 2-[[5-(diaminomethylideneamino)-2-[[2-(2-diazenylphenyl)acetyl]amino]pentanoyl]amino]propanoic acid |
| SMILES | [H]/N=N/c1ccccc1CC(=O)NC(CCCN=C(N)N)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C17H25N7O4/c1-10(16(27)28)22-15(26)13(7-4-8-21-17(18)19)23-14(25)9-11-5-2-3-6-12(11)24-20/h2-3,5-6,10,13,20H,4,7-9H2,1H3,(H,22,26)(H,23,25)(H,27,28)(H4,18,19,21)/b24-20+ |
| InChIKey | FIQGBKJYOPOCSX-HIXSDJFHSA-N |
| XLogP | 0.02 |
| TPSA | 196.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|