C36H55N7O5 — CID 163682613
(2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-ethoxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-2-benzyl-4-oxononanamide (PubChem CID 163682613) has the molecular formula C36H55N7O5 and a molecular weight of 665.88 g/mol. Its IUPAC name is (2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-ethoxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-2-benzyl-4-oxononanamide.
| Compound Name | (2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-ethoxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-2-benzyl-4-oxononanamide |
|---|---|
| PubChem CID | 163682613 |
| Molecular Formula | C36H55N7O5 |
| Molecular Weight | 665.88 g/mol |
| Exact Mass | 665.43 |
| IUPAC Name | (2R,5S)-9-amino-5-[[(2R,5R)-5-amino-8-(diaminomethylideneamino)-2-[(4-ethoxy-2,6-dimethylphenyl)methyl]-4-oxooctanoyl]amino]-2-benzyl-4-oxononanamide |
| SMILES | CCOc1cc(C)c(C[C@H](CC(=O)[C@H](N)CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)C[C@@H](Cc2ccccc2)C(N)=O)c(C)c1 |
| InChI | InChI=1S/C36H55N7O5/c1-4-48-28-17-23(2)29(24(3)18-28)20-27(22-32(44)30(38)13-10-16-42-36(40)41)35(47)43-31(14-8-9-15-37)33(45)21-26(34(39)46)19-25-11-6-5-7-12-25/h5-7,11-12,17-18,26-27,30-31H,4,8-10,13-16,19-22,37-38H2,1-3H3,(H2,39,46)(H,43,47)(H4,40,41,42)/t26-,27-,30-,31+/m1/s1 |
| InChIKey | JMBWBJONJWEWMI-QVGQUZRUSA-N |
| XLogP | 2.12 |
| TPSA | 232.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.88 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|