C27H46N8O5 — CID 167070245
(2R,5S)-9-amino-5-[[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-2-methyl-4-oxononanamide (PubChem CID 167070245) has the molecular formula C27H46N8O5 and a molecular weight of 562.72 g/mol. Its IUPAC name is (2R,5S)-9-amino-5-[[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-2-methyl-4-oxononanamide.
| Compound Name | (2R,5S)-9-amino-5-[[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-2-methyl-4-oxononanamide |
|---|---|
| PubChem CID | 167070245 |
| Molecular Formula | C27H46N8O5 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.36 |
| IUPAC Name | (2R,5S)-9-amino-5-[[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-2-methyl-4-oxononanamide |
| SMILES | Cc1cc(O)cc(C)c1C[C@H](NC(=O)[C@H](N)CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)C[C@@H](C)C(N)=O |
| InChI | InChI=1S/C27H46N8O5/c1-15-11-18(36)12-16(2)19(15)14-22(35-25(39)20(29)7-6-10-33-27(31)32)26(40)34-21(8-4-5-9-28)23(37)13-17(3)24(30)38/h11-12,17,20-22,36H,4-10,13-14,28-29H2,1-3H3,(H2,30,38)(H,34,40)(H,35,39)(H4,31,32,33)/t17-,20-,21+,22+/m1/s1 |
| InChIKey | AYAOTHMVAZHYLC-GFRNBQLOSA-N |
| XLogP | -0.89 |
| TPSA | 255.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|